C12H19N5O — CID 175802455
2-[pentyl([1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]ethanol (PubChem CID 175802455) has the molecular formula C12H19N5O and a molecular weight of 249.32 g/mol. Its IUPAC name is 2-[pentyl([1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]ethanol.
| Compound Name | 2-[pentyl([1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]ethanol |
|---|---|
| PubChem CID | 175802455 |
| Molecular Formula | C12H19N5O |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | 2-[pentyl([1,2,4]triazolo[1,5-a]pyrimidin-7-yl)amino]ethanol |
| SMILES | CCCCCN(CCO)c1ccnc2ncnn12 |
| InChI | InChI=1S/C12H19N5O/c1-2-3-4-7-16(8-9-18)11-5-6-13-12-14-10-15-17(11)12/h5-6,10,18H,2-4,7-9H2,1H3 |
| InChIKey | CBYOWCVCKMKDDU-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 66.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|