C14H15N — CID 175803221
2-[2-(1,1,2,2,3,3,3-heptadeuteriopropyl)phenyl]pyridine (PubChem CID 175803221) has the molecular formula C14H15N and a molecular weight of 204.32 g/mol. Its IUPAC name is 2-[2-(1,1,2,2,3,3,3-heptadeuteriopropyl)phenyl]pyridine.
| Compound Name | 2-[2-(1,1,2,2,3,3,3-heptadeuteriopropyl)phenyl]pyridine |
|---|---|
| PubChem CID | 175803221 |
| Molecular Formula | C14H15N |
| Molecular Weight | 204.32 g/mol |
| Exact Mass | 204.16 |
| IUPAC Name | 2-[2-(1,1,2,2,3,3,3-heptadeuteriopropyl)phenyl]pyridine |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])c1ccccc1-c1ccccn1 |
| InChI | InChI=1S/C14H15N/c1-2-7-12-8-3-4-9-13(12)14-10-5-6-11-15-14/h3-6,8-11H,2,7H2,1H3/i1D3,2D2,7D2 |
| InChIKey | XANZMCIQYZZGAN-OEPSAGCASA-N |
| XLogP | 3.70 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.32 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |