C17H25ClN2O5 — CID 175804582
(E)-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enamide;hydrochloride (PubChem CID 175804582) has the molecular formula C17H25ClN2O5 and a molecular weight of 372.85 g/mol. Its IUPAC name is (E)-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enamide;hydrochloride.
| Compound Name | (E)-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enamide;hydrochloride |
|---|---|
| PubChem CID | 175804582 |
| Molecular Formula | C17H25ClN2O5 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | (E)-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-3-(2,3-dihydro-1,4-benzodioxin-6-yl)prop-2-enamide;hydrochloride |
| SMILES | Cl.NCCOCCOCCNC(=O)/C=C/c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C17H24N2O5.ClH/c18-5-7-21-9-10-22-8-6-19-17(20)4-2-14-1-3-15-16(13-14)24-12-11-23-15;/h1-4,13H,5-12,18H2,(H,19,20);1H/b4-2+; |
| InChIKey | USBVXFSHMIXLED-VEELZWTKSA-N |
| XLogP | 1.00 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|