C21H28N4O3 — CID 175805439
butyl 4-[2-cyclopropyl-5-(3-methyl-1,2-oxazol-5-yl)pyrimidin-4-yl]piperidine-1-carboxylate (PubChem CID 175805439) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is butyl 4-[2-cyclopropyl-5-(3-methyl-1,2-oxazol-5-yl)pyrimidin-4-yl]piperidine-1-carboxylate.
| Compound Name | butyl 4-[2-cyclopropyl-5-(3-methyl-1,2-oxazol-5-yl)pyrimidin-4-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 175805439 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | butyl 4-[2-cyclopropyl-5-(3-methyl-1,2-oxazol-5-yl)pyrimidin-4-yl]piperidine-1-carboxylate |
| SMILES | CCCCOC(=O)N1CCC(c2nc(C3CC3)ncc2-c2cc(C)no2)CC1 |
| InChI | InChI=1S/C21H28N4O3/c1-3-4-11-27-21(26)25-9-7-15(8-10-25)19-17(18-12-14(2)24-28-18)13-22-20(23-19)16-5-6-16/h12-13,15-16H,3-11H2,1-2H3 |
| InChIKey | MCMYUINWBZWQEH-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 81.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|