About 3-aminopropyl(tributyl)phosphanium;hydrobromide
3-aminopropyl(tributyl)phosphanium;hydrobromide (PubChem CID 175805466) has the molecular formula C15H36BrNP+
and a molecular weight of 341.34 g/mol. Its IUPAC name is 3-aminopropyl(tributyl)phosphanium;hydrobromide.
Molecular Properties
| Compound Name | 3-aminopropyl(tributyl)phosphanium;hydrobromide |
| PubChem CID | 175805466 |
| Molecular Formula | C15H36BrNP+ |
| Molecular Weight | 341.34 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | 3-aminopropyl(tributyl)phosphanium;hydrobromide |
| SMILES | Br.CCCC[P+](CCCC)(CCCC)CCCN |
| InChI | InChI=1S/C15H35NP.BrH/c1-4-7-12-17(13-8-5-2,14-9-6-3)15-10-11-16;/h4-16H2,1-3H3;1H/q+1; |
| InChIKey | VSKLQQGKYWNXMV-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 341.34 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3-aminopropyl(tributyl)phosphanium;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminopropyl(tributyl)phosphanium;hydrobromide?
The IUPAC name of 3-aminopropyl(tributyl)phosphanium;hydrobromide (CID 175805466) is 3-aminopropyl(tributyl)phosphanium;hydrobromide.
What is the SMILES notation for 3-aminopropyl(tributyl)phosphanium;hydrobromide?
The canonical SMILES for 3-aminopropyl(tributyl)phosphanium;hydrobromide is Br.CCCC[P+](CCCC)(CCCC)CCCN.
What is the InChIKey of 3-aminopropyl(tributyl)phosphanium;hydrobromide?
The InChIKey is VSKLQQGKYWNXMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H35NP.BrH/c1-4-7-12-17(13-8-5-2,14-9-6-3)15-10-11-16;/h4-16H2,1-3H3;1H/q+1;.
What are the key properties of 3-aminopropyl(tributyl)phosphanium;hydrobromide?
3-aminopropyl(tributyl)phosphanium;hydrobromide has a molecular weight of 341.34 g/mol, XLogP of 5.33, 12 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminopropyl(tributyl)phosphanium;hydrobromide is sourced from PubChem (CID 175805466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).