C12H20O6S2 — CID 175807844
hexa-1,5-diene-3-sulfonic acid;prop-2-enyl prop-2-ene-1-sulfonate (PubChem CID 175807844) has the molecular formula C12H20O6S2 and a molecular weight of 324.42 g/mol. Its IUPAC name is hexa-1,5-diene-3-sulfonic acid;prop-2-enyl prop-2-ene-1-sulfonate.
| Compound Name | hexa-1,5-diene-3-sulfonic acid;prop-2-enyl prop-2-ene-1-sulfonate |
|---|---|
| PubChem CID | 175807844 |
| Molecular Formula | C12H20O6S2 |
| Molecular Weight | 324.42 g/mol |
| Exact Mass | 324.07 |
| IUPAC Name | hexa-1,5-diene-3-sulfonic acid;prop-2-enyl prop-2-ene-1-sulfonate |
| SMILES | C=CCC(C=C)S(=O)(=O)O.C=CCOS(=O)(=O)CC=C |
| InChI | InChI=1S/2C6H10O3S/c1-3-5-9-10(7,8)6-4-2;1-3-5-6(4-2)10(7,8)9/h3-4H,1-2,5-6H2;3-4,6H,1-2,5H2,(H,7,8,9) |
| InChIKey | GEMHEAXBNIXLIT-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.42 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|