C9H18ClNO3S — CID 126616062
1-amino-3-prop-2-enylhex-5-ene-2-sulfonic acid;hydrochloride (PubChem CID 126616062) has the molecular formula C9H18ClNO3S and a molecular weight of 255.77 g/mol. Its IUPAC name is 1-amino-3-prop-2-enylhex-5-ene-2-sulfonic acid;hydrochloride.
| Compound Name | 1-amino-3-prop-2-enylhex-5-ene-2-sulfonic acid;hydrochloride |
|---|---|
| PubChem CID | 126616062 |
| Molecular Formula | C9H18ClNO3S |
| Molecular Weight | 255.77 g/mol |
| Exact Mass | 255.07 |
| IUPAC Name | 1-amino-3-prop-2-enylhex-5-ene-2-sulfonic acid;hydrochloride |
| SMILES | C=CCC(CC=C)C(CN)S(=O)(=O)O.Cl |
| InChI | InChI=1S/C9H17NO3S.ClH/c1-3-5-8(6-4-2)9(7-10)14(11,12)13;/h3-4,8-9H,1-2,5-7,10H2,(H,11,12,13);1H |
| InChIKey | ACSJZAYONGGYSS-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.77 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|