C27H33F3N2O2 — CID 175808726
butyl N-[4-[[(1S,2R)-2-[4-[3-(trifluoromethyl)phenyl]phenyl]cyclopropyl]amino]cyclohexyl]carbamate (PubChem CID 175808726) has the molecular formula C27H33F3N2O2 and a molecular weight of 474.57 g/mol. Its IUPAC name is butyl N-[4-[[(1S,2R)-2-[4-[3-(trifluoromethyl)phenyl]phenyl]cyclopropyl]amino]cyclohexyl]carbamate.
| Compound Name | butyl N-[4-[[(1S,2R)-2-[4-[3-(trifluoromethyl)phenyl]phenyl]cyclopropyl]amino]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 175808726 |
| Molecular Formula | C27H33F3N2O2 |
| Molecular Weight | 474.57 g/mol |
| Exact Mass | 474.25 |
| IUPAC Name | butyl N-[4-[[(1S,2R)-2-[4-[3-(trifluoromethyl)phenyl]phenyl]cyclopropyl]amino]cyclohexyl]carbamate |
| SMILES | CCCCOC(=O)NC1CCC(N[C@H]2C[C@@H]2c2ccc(-c3cccc(C(F)(F)F)c3)cc2)CC1 |
| InChI | InChI=1S/C27H33F3N2O2/c1-2-3-15-34-26(33)32-23-13-11-22(12-14-23)31-25-17-24(25)19-9-7-18(8-10-19)20-5-4-6-21(16-20)27(28,29)30/h4-10,16,22-25,31H,2-3,11-15,17H2,1H3,(H,32,33)/t22?,23?,24-,25+/m1/s1 |
| InChIKey | SDKHFZONJBSTTM-CXMUWEKQSA-N |
| XLogP | 6.66 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.57 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|