C19H27NO5 — CID 123973069
butyl [3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]phenyl] carbonate (PubChem CID 123973069) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is butyl [3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]phenyl] carbonate.
| Compound Name | butyl [3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]phenyl] carbonate |
|---|---|
| PubChem CID | 123973069 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | butyl [3-[2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropyl]phenyl] carbonate |
| SMILES | CCCCOC(=O)Oc1cccc(C2CC2NC(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C19H27NO5/c1-5-6-10-23-18(22)24-14-9-7-8-13(11-14)15-12-16(15)20-17(21)25-19(2,3)4/h7-9,11,15-16H,5-6,10,12H2,1-4H3,(H,20,21) |
| InChIKey | NTEHLPMOFGNLOV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|