C19H27NO5 — CID 123775950
[2-[2-(butoxycarbonylamino)cyclopropyl]phenyl] tert-butyl carbonate (PubChem CID 123775950) has the molecular formula C19H27NO5 and a molecular weight of 349.43 g/mol. Its IUPAC name is [2-[2-(butoxycarbonylamino)cyclopropyl]phenyl] tert-butyl carbonate.
| Compound Name | [2-[2-(butoxycarbonylamino)cyclopropyl]phenyl] tert-butyl carbonate |
|---|---|
| PubChem CID | 123775950 |
| Molecular Formula | C19H27NO5 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.19 |
| IUPAC Name | [2-[2-(butoxycarbonylamino)cyclopropyl]phenyl] tert-butyl carbonate |
| SMILES | CCCCOC(=O)NC1CC1c1ccccc1OC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H27NO5/c1-5-6-11-23-17(21)20-15-12-14(15)13-9-7-8-10-16(13)24-18(22)25-19(2,3)4/h7-10,14-15H,5-6,11-12H2,1-4H3,(H,20,21) |
| InChIKey | ONNCJNUCGKDAGM-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|