C12H15NO3 — CID 79348552
2-hydroxyethyl N-(2-phenylcyclopropyl)carbamate (PubChem CID 79348552) has the molecular formula C12H15NO3 and a molecular weight of 221.26 g/mol. Its IUPAC name is 2-hydroxyethyl N-(2-phenylcyclopropyl)carbamate.
| Compound Name | 2-hydroxyethyl N-(2-phenylcyclopropyl)carbamate |
|---|---|
| PubChem CID | 79348552 |
| Molecular Formula | C12H15NO3 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | 2-hydroxyethyl N-(2-phenylcyclopropyl)carbamate |
| SMILES | O=C(NC1CC1c1ccccc1)OCCO |
| InChI | InChI=1S/C12H15NO3/c14-6-7-16-12(15)13-11-8-10(11)9-4-2-1-3-5-9/h1-5,10-11,14H,6-8H2,(H,13,15) |
| InChIKey | JBHRPLWWGUJQER-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |