C13H18N2O2 — CID 47764322
1-(3-hydroxypropyl)-3-(2-phenylcyclopropyl)urea (PubChem CID 47764322) has the molecular formula C13H18N2O2 and a molecular weight of 234.30 g/mol. Its IUPAC name is 1-(3-hydroxypropyl)-3-(2-phenylcyclopropyl)urea.
| Compound Name | 1-(3-hydroxypropyl)-3-(2-phenylcyclopropyl)urea |
|---|---|
| PubChem CID | 47764322 |
| Molecular Formula | C13H18N2O2 |
| Molecular Weight | 234.30 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | 1-(3-hydroxypropyl)-3-(2-phenylcyclopropyl)urea |
| SMILES | O=C(NCCCO)NC1CC1c1ccccc1 |
| InChI | InChI=1S/C13H18N2O2/c16-8-4-7-14-13(17)15-12-9-11(12)10-5-2-1-3-6-10/h1-3,5-6,11-12,16H,4,7-9H2,(H2,14,15,17) |
| InChIKey | HKEZNDCHYAVDLC-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.30 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|