C18H18Cl2N2O — CID 3323199
1-[2-(2,6-dichlorophenyl)ethyl]-3-(2-phenylcyclopropyl)urea (PubChem CID 3323199) has the molecular formula C18H18Cl2N2O and a molecular weight of 349.26 g/mol. Its IUPAC name is 1-[2-(2,6-dichlorophenyl)ethyl]-3-(2-phenylcyclopropyl)urea.
| Compound Name | 1-[2-(2,6-dichlorophenyl)ethyl]-3-(2-phenylcyclopropyl)urea |
|---|---|
| PubChem CID | 3323199 |
| Molecular Formula | C18H18Cl2N2O |
| Molecular Weight | 349.26 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 1-[2-(2,6-dichlorophenyl)ethyl]-3-(2-phenylcyclopropyl)urea |
| SMILES | O=C(NCCc1c(Cl)cccc1Cl)NC1CC1c1ccccc1 |
| InChI | InChI=1S/C18H18Cl2N2O/c19-15-7-4-8-16(20)13(15)9-10-21-18(23)22-17-11-14(17)12-5-2-1-3-6-12/h1-8,14,17H,9-11H2,(H2,21,22,23) |
| InChIKey | DPDJSTAFEZEMKT-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.26 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |