C13H17ClN2O2 — CID 97211780
1-[(1S,2R)-2-(4-chlorophenyl)cyclopropyl]-3-(2-methoxyethyl)urea (PubChem CID 97211780) has the molecular formula C13H17ClN2O2 and a molecular weight of 268.74 g/mol. Its IUPAC name is 1-[(1S,2R)-2-(4-chlorophenyl)cyclopropyl]-3-(2-methoxyethyl)urea.
| Compound Name | 1-[(1S,2R)-2-(4-chlorophenyl)cyclopropyl]-3-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 97211780 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 1-[(1S,2R)-2-(4-chlorophenyl)cyclopropyl]-3-(2-methoxyethyl)urea |
| SMILES | COCCNC(=O)N[C@H]1C[C@@H]1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H17ClN2O2/c1-18-7-6-15-13(17)16-12-8-11(12)9-2-4-10(14)5-3-9/h2-5,11-12H,6-8H2,1H3,(H2,15,16,17)/t11-,12+/m1/s1 |
| InChIKey | XDIKWVGEIZEXOY-NEPJUHHUSA-N |
| XLogP | 2.14 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|