C18H22ClN3O2 — CID 97030496
1-[(1S,2R)-2-(3-chlorophenyl)cyclopropyl]-3-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]urea (PubChem CID 97030496) has the molecular formula C18H22ClN3O2 and a molecular weight of 347.85 g/mol. Its IUPAC name is 1-[(1S,2R)-2-(3-chlorophenyl)cyclopropyl]-3-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]urea.
| Compound Name | 1-[(1S,2R)-2-(3-chlorophenyl)cyclopropyl]-3-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]urea |
|---|---|
| PubChem CID | 97030496 |
| Molecular Formula | C18H22ClN3O2 |
| Molecular Weight | 347.85 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 1-[(1S,2R)-2-(3-chlorophenyl)cyclopropyl]-3-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]urea |
| SMILES | Cc1noc(C)c1CCCNC(=O)N[C@H]1C[C@@H]1c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H22ClN3O2/c1-11-15(12(2)24-22-11)7-4-8-20-18(23)21-17-10-16(17)13-5-3-6-14(19)9-13/h3,5-6,9,16-17H,4,7-8,10H2,1-2H3,(H2,20,21,23)/t16-,17+/m1/s1 |
| InChIKey | PEWXZFDAAXIBFK-SJORKVTESA-N |
| XLogP | 3.73 |
| TPSA | 67.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.85 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|