C17H19N5O3 — CID 71973688
1-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-3-[3-(1,2,4-oxadiazol-3-yl)phenyl]urea (PubChem CID 71973688) has the molecular formula C17H19N5O3 and a molecular weight of 341.37 g/mol. Its IUPAC name is 1-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-3-[3-(1,2,4-oxadiazol-3-yl)phenyl]urea.
| Compound Name | 1-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-3-[3-(1,2,4-oxadiazol-3-yl)phenyl]urea |
|---|---|
| PubChem CID | 71973688 |
| Molecular Formula | C17H19N5O3 |
| Molecular Weight | 341.37 g/mol |
| Exact Mass | 341.15 |
| IUPAC Name | 1-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-3-[3-(1,2,4-oxadiazol-3-yl)phenyl]urea |
| SMILES | Cc1noc(C)c1CCCNC(=O)Nc1cccc(-c2ncon2)c1 |
| InChI | InChI=1S/C17H19N5O3/c1-11-15(12(2)25-21-11)7-4-8-18-17(23)20-14-6-3-5-13(9-14)16-19-10-24-22-16/h3,5-6,9-10H,4,7-8H2,1-2H3,(H2,18,20,23) |
| InChIKey | GQMQEPMXNDROBI-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 106.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|