C17H17N3O3 — CID 56803502
N-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-N'-(3-ethynylphenyl)oxamide (PubChem CID 56803502) has the molecular formula C17H17N3O3 and a molecular weight of 311.34 g/mol. Its IUPAC name is N-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-N'-(3-ethynylphenyl)oxamide.
| Compound Name | N-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-N'-(3-ethynylphenyl)oxamide |
|---|---|
| PubChem CID | 56803502 |
| Molecular Formula | C17H17N3O3 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.13 |
| IUPAC Name | N-[2-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl]-N'-(3-ethynylphenyl)oxamide |
| SMILES | C#Cc1cccc(NC(=O)C(=O)NCCc2c(C)noc2C)c1 |
| InChI | InChI=1S/C17H17N3O3/c1-4-13-6-5-7-14(10-13)19-17(22)16(21)18-9-8-15-11(2)20-23-12(15)3/h1,5-7,10H,8-9H2,2-3H3,(H,18,21)(H,19,22) |
| InChIKey | REJORZYCULWPIJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|