C19H23N3O3 — CID 95312423
N'-(3-ethynylphenyl)-N-[3-[(2R)-2-methylpiperidin-1-yl]-3-oxopropyl]oxamide (PubChem CID 95312423) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is N'-(3-ethynylphenyl)-N-[3-[(2R)-2-methylpiperidin-1-yl]-3-oxopropyl]oxamide.
| Compound Name | N'-(3-ethynylphenyl)-N-[3-[(2R)-2-methylpiperidin-1-yl]-3-oxopropyl]oxamide |
|---|---|
| PubChem CID | 95312423 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | N'-(3-ethynylphenyl)-N-[3-[(2R)-2-methylpiperidin-1-yl]-3-oxopropyl]oxamide |
| SMILES | C#Cc1cccc(NC(=O)C(=O)NCCC(=O)N2CCCC[C@H]2C)c1 |
| InChI | InChI=1S/C19H23N3O3/c1-3-15-8-6-9-16(13-15)21-19(25)18(24)20-11-10-17(23)22-12-5-4-7-14(22)2/h1,6,8-9,13-14H,4-5,7,10-12H2,2H3,(H,20,24)(H,21,25)/t14-/m1/s1 |
| InChIKey | HWWLZDZBJIPIAZ-CQSZACIVSA-N |
| XLogP | 1.51 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|