C19H25N3O3 — CID 95733928
(3R,6S)-1-N-(3-ethynylphenyl)-3-N-(2-methoxyethyl)-6-methylpiperidine-1,3-dicarboxamide (PubChem CID 95733928) has the molecular formula C19H25N3O3 and a molecular weight of 343.43 g/mol. Its IUPAC name is (3R,6S)-1-N-(3-ethynylphenyl)-3-N-(2-methoxyethyl)-6-methylpiperidine-1,3-dicarboxamide.
| Compound Name | (3R,6S)-1-N-(3-ethynylphenyl)-3-N-(2-methoxyethyl)-6-methylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 95733928 |
| Molecular Formula | C19H25N3O3 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.19 |
| IUPAC Name | (3R,6S)-1-N-(3-ethynylphenyl)-3-N-(2-methoxyethyl)-6-methylpiperidine-1,3-dicarboxamide |
| SMILES | C#Cc1cccc(NC(=O)N2C[C@H](C(=O)NCCOC)CC[C@@H]2C)c1 |
| InChI | InChI=1S/C19H25N3O3/c1-4-15-6-5-7-17(12-15)21-19(24)22-13-16(9-8-14(22)2)18(23)20-10-11-25-3/h1,5-7,12,14,16H,8-11,13H2,2-3H3,(H,20,23)(H,21,24)/t14-,16+/m0/s1 |
| InChIKey | UAKOEGRUBRIREW-GOEBONIOSA-N |
| XLogP | 2.06 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|