C19H28N2O3 — CID 97072416
(3R,6R)-1-(2,3-dimethylbenzoyl)-N-(2-methoxyethyl)-6-methylpiperidine-3-carboxamide (PubChem CID 97072416) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is (3R,6R)-1-(2,3-dimethylbenzoyl)-N-(2-methoxyethyl)-6-methylpiperidine-3-carboxamide.
| Compound Name | (3R,6R)-1-(2,3-dimethylbenzoyl)-N-(2-methoxyethyl)-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 97072416 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | (3R,6R)-1-(2,3-dimethylbenzoyl)-N-(2-methoxyethyl)-6-methylpiperidine-3-carboxamide |
| SMILES | COCCNC(=O)[C@@H]1CC[C@@H](C)N(C(=O)c2cccc(C)c2C)C1 |
| InChI | InChI=1S/C19H28N2O3/c1-13-6-5-7-17(15(13)3)19(23)21-12-16(9-8-14(21)2)18(22)20-10-11-24-4/h5-7,14,16H,8-12H2,1-4H3,(H,20,22)/t14-,16-/m1/s1 |
| InChIKey | BUAYWRRITUBTQQ-GDBMZVCRSA-N |
| XLogP | 2.31 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|