C20H26N4O3 — CID 48812935
3-N-(2-methoxyethyl)-6-methyl-1-N-quinolin-8-ylpiperidine-1,3-dicarboxamide (PubChem CID 48812935) has the molecular formula C20H26N4O3 and a molecular weight of 370.45 g/mol. Its IUPAC name is 3-N-(2-methoxyethyl)-6-methyl-1-N-quinolin-8-ylpiperidine-1,3-dicarboxamide.
| Compound Name | 3-N-(2-methoxyethyl)-6-methyl-1-N-quinolin-8-ylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 48812935 |
| Molecular Formula | C20H26N4O3 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.20 |
| IUPAC Name | 3-N-(2-methoxyethyl)-6-methyl-1-N-quinolin-8-ylpiperidine-1,3-dicarboxamide |
| SMILES | COCCNC(=O)C1CCC(C)N(C(=O)Nc2cccc3cccnc23)C1 |
| InChI | InChI=1S/C20H26N4O3/c1-14-8-9-16(19(25)22-11-12-27-2)13-24(14)20(26)23-17-7-3-5-15-6-4-10-21-18(15)17/h3-7,10,14,16H,8-9,11-13H2,1-2H3,(H,22,25)(H,23,26) |
| InChIKey | PUZNSQFXZXUJRN-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|