C18H24N4O3 — CID 95290519
(3R,6S)-1-N-(3-cyanophenyl)-3-N-(2-methoxyethyl)-6-methylpiperidine-1,3-dicarboxamide (PubChem CID 95290519) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is (3R,6S)-1-N-(3-cyanophenyl)-3-N-(2-methoxyethyl)-6-methylpiperidine-1,3-dicarboxamide.
| Compound Name | (3R,6S)-1-N-(3-cyanophenyl)-3-N-(2-methoxyethyl)-6-methylpiperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 95290519 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | (3R,6S)-1-N-(3-cyanophenyl)-3-N-(2-methoxyethyl)-6-methylpiperidine-1,3-dicarboxamide |
| SMILES | COCCNC(=O)[C@@H]1CC[C@H](C)N(C(=O)Nc2cccc(C#N)c2)C1 |
| InChI | InChI=1S/C18H24N4O3/c1-13-6-7-15(17(23)20-8-9-25-2)12-22(13)18(24)21-16-5-3-4-14(10-16)11-19/h3-5,10,13,15H,6-9,12H2,1-2H3,(H,20,23)(H,21,24)/t13-,15+/m0/s1 |
| InChIKey | YPDMXHGWGHVTGO-DZGCQCFKSA-N |
| XLogP | 1.95 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|