C17H22F2N2O3 — CID 94671496
(3S,6S)-1-(3,4-difluorobenzoyl)-N-(2-methoxyethyl)-6-methylpiperidine-3-carboxamide (PubChem CID 94671496) has the molecular formula C17H22F2N2O3 and a molecular weight of 340.37 g/mol. Its IUPAC name is (3S,6S)-1-(3,4-difluorobenzoyl)-N-(2-methoxyethyl)-6-methylpiperidine-3-carboxamide.
| Compound Name | (3S,6S)-1-(3,4-difluorobenzoyl)-N-(2-methoxyethyl)-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 94671496 |
| Molecular Formula | C17H22F2N2O3 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | (3S,6S)-1-(3,4-difluorobenzoyl)-N-(2-methoxyethyl)-6-methylpiperidine-3-carboxamide |
| SMILES | COCCNC(=O)[C@H]1CC[C@H](C)N(C(=O)c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C17H22F2N2O3/c1-11-3-4-13(16(22)20-7-8-24-2)10-21(11)17(23)12-5-6-14(18)15(19)9-12/h5-6,9,11,13H,3-4,7-8,10H2,1-2H3,(H,20,22)/t11-,13-/m0/s1 |
| InChIKey | BRJNUSMJPYGKQV-AAEUAGOBSA-N |
| XLogP | 1.97 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|