C19H28N2O3 — CID 94671477
(3R,6R)-1-(4-ethylbenzoyl)-N-(2-methoxyethyl)-6-methylpiperidine-3-carboxamide (PubChem CID 94671477) has the molecular formula C19H28N2O3 and a molecular weight of 332.44 g/mol. Its IUPAC name is (3R,6R)-1-(4-ethylbenzoyl)-N-(2-methoxyethyl)-6-methylpiperidine-3-carboxamide.
| Compound Name | (3R,6R)-1-(4-ethylbenzoyl)-N-(2-methoxyethyl)-6-methylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 94671477 |
| Molecular Formula | C19H28N2O3 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.21 |
| IUPAC Name | (3R,6R)-1-(4-ethylbenzoyl)-N-(2-methoxyethyl)-6-methylpiperidine-3-carboxamide |
| SMILES | CCc1ccc(C(=O)N2C[C@H](C(=O)NCCOC)CC[C@H]2C)cc1 |
| InChI | InChI=1S/C19H28N2O3/c1-4-15-6-9-16(10-7-15)19(23)21-13-17(8-5-14(21)2)18(22)20-11-12-24-3/h6-7,9-10,14,17H,4-5,8,11-13H2,1-3H3,(H,20,22)/t14-,17-/m1/s1 |
| InChIKey | JAPXEBHBLPKUQW-RHSMWYFYSA-N |
| XLogP | 2.25 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|