C24H29FN2O3 — CID 92994964
(3S,5R)-5-(4-ethylphenyl)-1-(4-fluorobenzoyl)-N-(2-methoxyethyl)piperidine-3-carboxamide (PubChem CID 92994964) has the molecular formula C24H29FN2O3 and a molecular weight of 412.51 g/mol. Its IUPAC name is (3S,5R)-5-(4-ethylphenyl)-1-(4-fluorobenzoyl)-N-(2-methoxyethyl)piperidine-3-carboxamide.
| Compound Name | (3S,5R)-5-(4-ethylphenyl)-1-(4-fluorobenzoyl)-N-(2-methoxyethyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 92994964 |
| Molecular Formula | C24H29FN2O3 |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.22 |
| IUPAC Name | (3S,5R)-5-(4-ethylphenyl)-1-(4-fluorobenzoyl)-N-(2-methoxyethyl)piperidine-3-carboxamide |
| SMILES | CCc1ccc([C@H]2C[C@H](C(=O)NCCOC)CN(C(=O)c3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C24H29FN2O3/c1-3-17-4-6-18(7-5-17)20-14-21(23(28)26-12-13-30-2)16-27(15-20)24(29)19-8-10-22(25)11-9-19/h4-11,20-21H,3,12-16H2,1-2H3,(H,26,28)/t20-,21-/m0/s1 |
| InChIKey | LBRVHXLPVCQWFI-SFTDATJTSA-N |
| XLogP | 3.40 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|