C17H23N3O5 — CID 119182103
6-[5-(2-methoxyethylcarbamoyl)-2-methylpiperidine-1-carbonyl]pyridine-2-carboxylic acid (PubChem CID 119182103) has the molecular formula C17H23N3O5 and a molecular weight of 349.39 g/mol. Its IUPAC name is 6-[5-(2-methoxyethylcarbamoyl)-2-methylpiperidine-1-carbonyl]pyridine-2-carboxylic acid.
| Compound Name | 6-[5-(2-methoxyethylcarbamoyl)-2-methylpiperidine-1-carbonyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 119182103 |
| Molecular Formula | C17H23N3O5 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 6-[5-(2-methoxyethylcarbamoyl)-2-methylpiperidine-1-carbonyl]pyridine-2-carboxylic acid |
| SMILES | COCCNC(=O)C1CCC(C)N(C(=O)c2cccc(C(=O)O)n2)C1 |
| InChI | InChI=1S/C17H23N3O5/c1-11-6-7-12(15(21)18-8-9-25-2)10-20(11)16(22)13-4-3-5-14(19-13)17(23)24/h3-5,11-12H,6-10H2,1-2H3,(H,18,21)(H,23,24) |
| InChIKey | XVEBIPUCFOOGQV-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 108.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|