C24H36N4O5 — CID 138993226
3-N-(2-methoxyethyl)-6-methyl-1-N-[[3-(oxolan-2-ylmethylcarbamoyl)phenyl]methyl]piperidine-1,3-dicarboxamide (PubChem CID 138993226) has the molecular formula C24H36N4O5 and a molecular weight of 460.58 g/mol. Its IUPAC name is 3-N-(2-methoxyethyl)-6-methyl-1-N-[[3-(oxolan-2-ylmethylcarbamoyl)phenyl]methyl]piperidine-1,3-dicarboxamide.
| Compound Name | 3-N-(2-methoxyethyl)-6-methyl-1-N-[[3-(oxolan-2-ylmethylcarbamoyl)phenyl]methyl]piperidine-1,3-dicarboxamide |
|---|---|
| PubChem CID | 138993226 |
| Molecular Formula | C24H36N4O5 |
| Molecular Weight | 460.58 g/mol |
| Exact Mass | 460.27 |
| IUPAC Name | 3-N-(2-methoxyethyl)-6-methyl-1-N-[[3-(oxolan-2-ylmethylcarbamoyl)phenyl]methyl]piperidine-1,3-dicarboxamide |
| SMILES | COCCNC(=O)C1CCC(C)N(C(=O)NCc2cccc(C(=O)NCC3CCCO3)c2)C1 |
| InChI | InChI=1S/C24H36N4O5/c1-17-8-9-20(23(30)25-10-12-32-2)16-28(17)24(31)27-14-18-5-3-6-19(13-18)22(29)26-15-21-7-4-11-33-21/h3,5-6,13,17,20-21H,4,7-12,14-16H2,1-2H3,(H,25,30)(H,26,29)(H,27,31) |
| InChIKey | FUEYIFCHZDWHJZ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 109.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.58 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|