C18H28ClN3O3 — CID 120561368
3-[(4-aminopentanoylamino)methyl]-N-(oxolan-2-ylmethyl)benzamide;hydrochloride (PubChem CID 120561368) has the molecular formula C18H28ClN3O3 and a molecular weight of 369.89 g/mol. Its IUPAC name is 3-[(4-aminopentanoylamino)methyl]-N-(oxolan-2-ylmethyl)benzamide;hydrochloride.
| Compound Name | 3-[(4-aminopentanoylamino)methyl]-N-(oxolan-2-ylmethyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 120561368 |
| Molecular Formula | C18H28ClN3O3 |
| Molecular Weight | 369.89 g/mol |
| Exact Mass | 369.18 |
| IUPAC Name | 3-[(4-aminopentanoylamino)methyl]-N-(oxolan-2-ylmethyl)benzamide;hydrochloride |
| SMILES | CC(N)CCC(=O)NCc1cccc(C(=O)NCC2CCCO2)c1.Cl |
| InChI | InChI=1S/C18H27N3O3.ClH/c1-13(19)7-8-17(22)20-11-14-4-2-5-15(10-14)18(23)21-12-16-6-3-9-24-16;/h2,4-5,10,13,16H,3,6-9,11-12,19H2,1H3,(H,20,22)(H,21,23);1H |
| InChIKey | DPSSDUAZLCBKFP-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.89 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |