C18H27N3O4 — CID 120590388
3-[[(4-amino-3-methoxybutanoyl)amino]methyl]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 120590388) has the molecular formula C18H27N3O4 and a molecular weight of 349.43 g/mol. Its IUPAC name is 3-[[(4-amino-3-methoxybutanoyl)amino]methyl]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 3-[[(4-amino-3-methoxybutanoyl)amino]methyl]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 120590388 |
| Molecular Formula | C18H27N3O4 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.20 |
| IUPAC Name | 3-[[(4-amino-3-methoxybutanoyl)amino]methyl]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | COC(CN)CC(=O)NCc1cccc(C(=O)NCC2CCCO2)c1 |
| InChI | InChI=1S/C18H27N3O4/c1-24-16(10-19)9-17(22)20-11-13-4-2-5-14(8-13)18(23)21-12-15-6-3-7-25-15/h2,4-5,8,15-16H,3,6-7,9-12,19H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | CXGYYTMWHFTDBS-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |