C19H24N2O3 — CID 94816645
3-[[[(2E,4E)-hexa-2,4-dienoyl]amino]methyl]-N-[[(2R)-oxolan-2-yl]methyl]benzamide (PubChem CID 94816645) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is 3-[[[(2E,4E)-hexa-2,4-dienoyl]amino]methyl]-N-[[(2R)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 3-[[[(2E,4E)-hexa-2,4-dienoyl]amino]methyl]-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 94816645 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | 3-[[[(2E,4E)-hexa-2,4-dienoyl]amino]methyl]-N-[[(2R)-oxolan-2-yl]methyl]benzamide |
| SMILES | C/C=C/C=C/C(=O)NCc1cccc(C(=O)NC[C@H]2CCCO2)c1 |
| InChI | InChI=1S/C19H24N2O3/c1-2-3-4-10-18(22)20-13-15-7-5-8-16(12-15)19(23)21-14-17-9-6-11-24-17/h2-5,7-8,10,12,17H,6,9,11,13-14H2,1H3,(H,20,22)(H,21,23)/b3-2+,10-4+/t17-/m1/s1 |
| InChIKey | WIHQAFXZBDJQHM-ISDVNKQXSA-N |
| XLogP | 2.34 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|