C21H21N3O2 — CID 71875733
N'-(3-ethynylphenyl)-N-[1-(4-methylphenyl)pyrrolidin-3-yl]oxamide (PubChem CID 71875733) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is N'-(3-ethynylphenyl)-N-[1-(4-methylphenyl)pyrrolidin-3-yl]oxamide.
| Compound Name | N'-(3-ethynylphenyl)-N-[1-(4-methylphenyl)pyrrolidin-3-yl]oxamide |
|---|---|
| PubChem CID | 71875733 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | N'-(3-ethynylphenyl)-N-[1-(4-methylphenyl)pyrrolidin-3-yl]oxamide |
| SMILES | C#Cc1cccc(NC(=O)C(=O)NC2CCN(c3ccc(C)cc3)C2)c1 |
| InChI | InChI=1S/C21H21N3O2/c1-3-16-5-4-6-17(13-16)22-20(25)21(26)23-18-11-12-24(14-18)19-9-7-15(2)8-10-19/h1,4-10,13,18H,11-12,14H2,2H3,(H,22,25)(H,23,26) |
| InChIKey | LDBCQKWIZGACFM-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|