C18H23N7O2 — CID 118780012
1-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-3-[2,3-dimethyl-5-(tetrazol-1-yl)phenyl]urea (PubChem CID 118780012) has the molecular formula C18H23N7O2 and a molecular weight of 369.43 g/mol. Its IUPAC name is 1-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-3-[2,3-dimethyl-5-(tetrazol-1-yl)phenyl]urea.
| Compound Name | 1-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-3-[2,3-dimethyl-5-(tetrazol-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 118780012 |
| Molecular Formula | C18H23N7O2 |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.19 |
| IUPAC Name | 1-[3-(3,5-dimethyl-1,2-oxazol-4-yl)propyl]-3-[2,3-dimethyl-5-(tetrazol-1-yl)phenyl]urea |
| SMILES | Cc1cc(-n2cnnn2)cc(NC(=O)NCCCc2c(C)noc2C)c1C |
| InChI | InChI=1S/C18H23N7O2/c1-11-8-15(25-10-20-23-24-25)9-17(12(11)2)21-18(26)19-7-5-6-16-13(3)22-27-14(16)4/h8-10H,5-7H2,1-4H3,(H2,19,21,26) |
| InChIKey | HMYLDHKEGWREGK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 110.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|