C28H36N4O3 — CID 175809802
2-(4-cyclohexyloxyphenyl)-6-methoxy-7-[(1-methylpiperidin-4-yl)methoxy]quinazolin-4-amine (PubChem CID 175809802) has the molecular formula C28H36N4O3 and a molecular weight of 476.62 g/mol. Its IUPAC name is 2-(4-cyclohexyloxyphenyl)-6-methoxy-7-[(1-methylpiperidin-4-yl)methoxy]quinazolin-4-amine.
| Compound Name | 2-(4-cyclohexyloxyphenyl)-6-methoxy-7-[(1-methylpiperidin-4-yl)methoxy]quinazolin-4-amine |
|---|---|
| PubChem CID | 175809802 |
| Molecular Formula | C28H36N4O3 |
| Molecular Weight | 476.62 g/mol |
| Exact Mass | 476.28 |
| IUPAC Name | 2-(4-cyclohexyloxyphenyl)-6-methoxy-7-[(1-methylpiperidin-4-yl)methoxy]quinazolin-4-amine |
| SMILES | COc1cc2c(N)nc(-c3ccc(OC4CCCCC4)cc3)nc2cc1OCC1CCN(C)CC1 |
| InChI | InChI=1S/C28H36N4O3/c1-32-14-12-19(13-15-32)18-34-26-17-24-23(16-25(26)33-2)27(29)31-28(30-24)20-8-10-22(11-9-20)35-21-6-4-3-5-7-21/h8-11,16-17,19,21H,3-7,12-15,18H2,1-2H3,(H2,29,30,31) |
| InChIKey | MTLKQBCKDAKYKO-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 82.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.62 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |