C18H9FN4O2 — CID 175812664
7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)pyrimido[4,5-d]pyridazin-8-one (PubChem CID 175812664) has the molecular formula C18H9FN4O2 and a molecular weight of 332.29 g/mol. Its IUPAC name is 7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)pyrimido[4,5-d]pyridazin-8-one.
| Compound Name | 7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)pyrimido[4,5-d]pyridazin-8-one |
|---|---|
| PubChem CID | 175812664 |
| Molecular Formula | C18H9FN4O2 |
| Molecular Weight | 332.29 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | 7-(8-ethynyl-7-fluoro-3-hydroxynaphthalen-1-yl)pyrimido[4,5-d]pyridazin-8-one |
| SMILES | C#Cc1c(F)ccc2cc(O)cc(-n3ncc4cncnc4c3=O)c12 |
| InChI | InChI=1S/C18H9FN4O2/c1-2-13-14(19)4-3-10-5-12(24)6-15(16(10)13)23-18(25)17-11(8-22-23)7-20-9-21-17/h1,3-9,24H |
| InChIKey | PYNFUWWJAKTOMV-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|