C20H15N3O2 — CID 175812795
2-ethenyl-5-(phenanthridin-6-ylmethyl)-1,3-oxazole-4-carboxamide (PubChem CID 175812795) has the molecular formula C20H15N3O2 and a molecular weight of 329.36 g/mol. Its IUPAC name is 2-ethenyl-5-(phenanthridin-6-ylmethyl)-1,3-oxazole-4-carboxamide.
| Compound Name | 2-ethenyl-5-(phenanthridin-6-ylmethyl)-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 175812795 |
| Molecular Formula | C20H15N3O2 |
| Molecular Weight | 329.36 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 2-ethenyl-5-(phenanthridin-6-ylmethyl)-1,3-oxazole-4-carboxamide |
| SMILES | C=Cc1nc(C(N)=O)c(Cc2nc3ccccc3c3ccccc23)o1 |
| InChI | InChI=1S/C20H15N3O2/c1-2-18-23-19(20(21)24)17(25-18)11-16-14-9-4-3-7-12(14)13-8-5-6-10-15(13)22-16/h2-10H,1,11H2,(H2,21,24) |
| InChIKey | RHXDENOKDFNUCS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 82.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.36 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|