C18H20N2O — CID 173330243
4-ethyl-2-hexa-2,4-dienylquinoline-3-carboxamide (PubChem CID 173330243) has the molecular formula C18H20N2O and a molecular weight of 280.37 g/mol. Its IUPAC name is 4-ethyl-2-hexa-2,4-dienylquinoline-3-carboxamide.
| Compound Name | 4-ethyl-2-hexa-2,4-dienylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 173330243 |
| Molecular Formula | C18H20N2O |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.16 |
| IUPAC Name | 4-ethyl-2-hexa-2,4-dienylquinoline-3-carboxamide |
| SMILES | CC=CC=CCc1nc2ccccc2c(CC)c1C(N)=O |
| InChI | InChI=1S/C18H20N2O/c1-3-5-6-7-12-16-17(18(19)21)13(4-2)14-10-8-9-11-15(14)20-16/h3,5-11H,4,12H2,1-2H3,(H2,19,21) |
| InChIKey | CAPIXASLJJUWML-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|