C16H18N2O3 — CID 3941582
(1-amino-1-oxopropan-2-yl) 2-ethyl-3-methylquinoline-4-carboxylate (PubChem CID 3941582) has the molecular formula C16H18N2O3 and a molecular weight of 286.33 g/mol. Its IUPAC name is (1-amino-1-oxopropan-2-yl) 2-ethyl-3-methylquinoline-4-carboxylate.
| Compound Name | (1-amino-1-oxopropan-2-yl) 2-ethyl-3-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 3941582 |
| Molecular Formula | C16H18N2O3 |
| Molecular Weight | 286.33 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | (1-amino-1-oxopropan-2-yl) 2-ethyl-3-methylquinoline-4-carboxylate |
| SMILES | CCc1nc2ccccc2c(C(=O)OC(C)C(N)=O)c1C |
| InChI | InChI=1S/C16H18N2O3/c1-4-12-9(2)14(16(20)21-10(3)15(17)19)11-7-5-6-8-13(11)18-12/h5-8,10H,4H2,1-3H3,(H2,17,19) |
| InChIKey | AHLFLIJWOBUDCR-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 82.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |