C22H19F3N2O3 — CID 7847109
[(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-ethyl-3-methylquinoline-4-carboxylate (PubChem CID 7847109) has the molecular formula C22H19F3N2O3 and a molecular weight of 416.40 g/mol. Its IUPAC name is [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-ethyl-3-methylquinoline-4-carboxylate.
| Compound Name | [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-ethyl-3-methylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 7847109 |
| Molecular Formula | C22H19F3N2O3 |
| Molecular Weight | 416.40 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | [(2S)-1-oxo-1-(2,3,4-trifluoroanilino)propan-2-yl] 2-ethyl-3-methylquinoline-4-carboxylate |
| SMILES | CCc1nc2ccccc2c(C(=O)O[C@@H](C)C(=O)Nc2ccc(F)c(F)c2F)c1C |
| InChI | InChI=1S/C22H19F3N2O3/c1-4-15-11(2)18(13-7-5-6-8-16(13)26-15)22(29)30-12(3)21(28)27-17-10-9-14(23)19(24)20(17)25/h5-10,12H,4H2,1-3H3,(H,27,28)/t12-/m0/s1 |
| InChIKey | ANTZMZGFRHLTRS-LBPRGKRZSA-N |
| XLogP | 4.71 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.40 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|