C23H26ClN5O2 — CID 175812910
tert-butyl (3aS,6aR)-5-[[5-chloro-4-(4-cyanophenyl)pyrimidin-2-yl]amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate (PubChem CID 175812910) has the molecular formula C23H26ClN5O2 and a molecular weight of 439.95 g/mol. Its IUPAC name is tert-butyl (3aS,6aR)-5-[[5-chloro-4-(4-cyanophenyl)pyrimidin-2-yl]amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate.
| Compound Name | tert-butyl (3aS,6aR)-5-[[5-chloro-4-(4-cyanophenyl)pyrimidin-2-yl]amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 175812910 |
| Molecular Formula | C23H26ClN5O2 |
| Molecular Weight | 439.95 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | tert-butyl (3aS,6aR)-5-[[5-chloro-4-(4-cyanophenyl)pyrimidin-2-yl]amino]-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrole-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CC(Nc3ncc(Cl)c(-c4ccc(C#N)cc4)n3)C[C@H]2C1 |
| InChI | InChI=1S/C23H26ClN5O2/c1-23(2,3)31-22(30)29-12-16-8-18(9-17(16)13-29)27-21-26-11-19(24)20(28-21)15-6-4-14(10-25)5-7-15/h4-7,11,16-18H,8-9,12-13H2,1-3H3,(H,26,27,28)/t16-,17+,18? |
| InChIKey | PHHIETSEYSFMOV-JWTNVVGKSA-N |
| XLogP | 4.73 |
| TPSA | 91.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.95 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |