About 1-[[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]methyl]indole
1-[[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]methyl]indole (PubChem CID 175814165) has the molecular formula C19H23N5
and a molecular weight of 321.43 g/mol. Its IUPAC name is 1-[[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]methyl]indole.
Molecular Properties
| Compound Name | 1-[[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]methyl]indole |
| PubChem CID | 175814165 |
| Molecular Formula | C19H23N5 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.20 |
| IUPAC Name | 1-[[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]methyl]indole |
| SMILES | Cc1ncnc(N2CCN(Cn3ccc4ccccc43)CC2)c1C |
| InChI | InChI=1S/C19H23N5/c1-15-16(2)20-13-21-19(15)23-11-9-22(10-12-23)14-24-8-7-17-5-3-4-6-18(17)24/h3-8,13H,9-12,14H2,1-2H3 |
| InChIKey | DRTNUVFWVPGPJO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 37.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-[[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]methyl]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]methyl]indole?
The IUPAC name of 1-[[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]methyl]indole (CID 175814165) is 1-[[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]methyl]indole.
What is the SMILES notation for 1-[[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]methyl]indole?
The canonical SMILES for 1-[[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]methyl]indole is Cc1ncnc(N2CCN(Cn3ccc4ccccc43)CC2)c1C.
What is the InChIKey of 1-[[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]methyl]indole?
The InChIKey is DRTNUVFWVPGPJO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N5/c1-15-16(2)20-13-21-19(15)23-11-9-22(10-12-23)14-24-8-7-17-5-3-4-6-18(17)24/h3-8,13H,9-12,14H2,1-2H3.
What are the key properties of 1-[[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]methyl]indole?
1-[[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]methyl]indole has a molecular weight of 321.43 g/mol, XLogP of 2.83, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[4-(5,6-dimethylpyrimidin-4-yl)piperazin-1-yl]methyl]indole is sourced from PubChem (CID 175814165), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).