C17H22N4 — CID 154829084
4,5-dimethyl-6-[4-(3-methylphenyl)piperazin-1-yl]pyrimidine (PubChem CID 154829084) has the molecular formula C17H22N4 and a molecular weight of 282.39 g/mol. Its IUPAC name is 4,5-dimethyl-6-[4-(3-methylphenyl)piperazin-1-yl]pyrimidine.
| Compound Name | 4,5-dimethyl-6-[4-(3-methylphenyl)piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 154829084 |
| Molecular Formula | C17H22N4 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 4,5-dimethyl-6-[4-(3-methylphenyl)piperazin-1-yl]pyrimidine |
| SMILES | Cc1cccc(N2CCN(c3ncnc(C)c3C)CC2)c1 |
| InChI | InChI=1S/C17H22N4/c1-13-5-4-6-16(11-13)20-7-9-21(10-8-20)17-14(2)15(3)18-12-19-17/h4-6,11-12H,7-10H2,1-3H3 |
| InChIKey | ICCWCBVKQRAGED-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |