C22H23N6+ — CID 163459861
4-[4-(3-methylphenyl)piperazin-1-yl]-6-(1H-pyrazol-1-ium-4-yl)quinazoline (PubChem CID 163459861) has the molecular formula C22H23N6+ and a molecular weight of 371.47 g/mol. Its IUPAC name is 4-[4-(3-methylphenyl)piperazin-1-yl]-6-(1H-pyrazol-1-ium-4-yl)quinazoline.
| Compound Name | 4-[4-(3-methylphenyl)piperazin-1-yl]-6-(1H-pyrazol-1-ium-4-yl)quinazoline |
|---|---|
| PubChem CID | 163459861 |
| Molecular Formula | C22H23N6+ |
| Molecular Weight | 371.47 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 4-[4-(3-methylphenyl)piperazin-1-yl]-6-(1H-pyrazol-1-ium-4-yl)quinazoline |
| SMILES | Cc1cccc(N2CCN(c3ncnc4ccc(C5=C[NH2+]N=C5)cc34)CC2)c1 |
| InChI | InChI=1S/C22H22N6/c1-16-3-2-4-19(11-16)27-7-9-28(10-8-27)22-20-12-17(18-13-25-26-14-18)5-6-21(20)23-15-24-22/h2-6,11-15H,7-10H2,1H3,(H,25,26)/p+1 |
| InChIKey | BNQOMJKZFRKJPI-UHFFFAOYSA-O |
| XLogP | 2.17 |
| TPSA | 61.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.47 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|