C10H20O — CID 175815992
1,2,2,3,3-pentadeuteriodecan-1-one (PubChem CID 175815992) has the molecular formula C10H20O and a molecular weight of 161.30 g/mol. Its IUPAC name is 1,2,2,3,3-pentadeuteriodecan-1-one.
| Compound Name | 1,2,2,3,3-pentadeuteriodecan-1-one |
|---|---|
| PubChem CID | 175815992 |
| Molecular Formula | C10H20O |
| Molecular Weight | 161.30 g/mol |
| Exact Mass | 161.18 |
| IUPAC Name | 1,2,2,3,3-pentadeuteriodecan-1-one |
| SMILES | [2H]C(=O)C([2H])([2H])C([2H])([2H])CCCCCCC |
| InChI | InChI=1S/C10H20O/c1-2-3-4-5-6-7-8-9-10-11/h10H,2-9H2,1H3/i8D2,9D2,10D |
| InChIKey | KSMVZQYAVGTKIV-GFWWIRCNSA-N |
| XLogP | 3.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.30 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|