C9H11F2N3O4 — CID 175819575
1-[(2R)-1,1-difluoropropan-2-yl]-4-nitro-3-(oxetan-3-yloxy)pyrazole (PubChem CID 175819575) has the molecular formula C9H11F2N3O4 and a molecular weight of 263.20 g/mol. Its IUPAC name is 1-[(2R)-1,1-difluoropropan-2-yl]-4-nitro-3-(oxetan-3-yloxy)pyrazole.
| Compound Name | 1-[(2R)-1,1-difluoropropan-2-yl]-4-nitro-3-(oxetan-3-yloxy)pyrazole |
|---|---|
| PubChem CID | 175819575 |
| Molecular Formula | C9H11F2N3O4 |
| Molecular Weight | 263.20 g/mol |
| Exact Mass | 263.07 |
| IUPAC Name | 1-[(2R)-1,1-difluoropropan-2-yl]-4-nitro-3-(oxetan-3-yloxy)pyrazole |
| SMILES | C[C@H](C(F)F)n1cc([N+](=O)[O-])c(OC2COC2)n1 |
| InChI | InChI=1S/C9H11F2N3O4/c1-5(8(10)11)13-2-7(14(15)16)9(12-13)18-6-3-17-4-6/h2,5-6,8H,3-4H2,1H3/t5-/m1/s1 |
| InChIKey | YNRPHBSEUOSYIS-RXMQYKEDSA-N |
| XLogP | 1.39 |
| TPSA | 79.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.20 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|