C8H11N3O4 — CID 166513174
3-[(2S,3S)-2-methyloxetan-3-yl]oxy-4-nitro-1-(trideuteriomethyl)pyrazole (PubChem CID 166513174) has the molecular formula C8H11N3O4 and a molecular weight of 216.21 g/mol. Its IUPAC name is 3-[(2S,3S)-2-methyloxetan-3-yl]oxy-4-nitro-1-(trideuteriomethyl)pyrazole.
| Compound Name | 3-[(2S,3S)-2-methyloxetan-3-yl]oxy-4-nitro-1-(trideuteriomethyl)pyrazole |
|---|---|
| PubChem CID | 166513174 |
| Molecular Formula | C8H11N3O4 |
| Molecular Weight | 216.21 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 3-[(2S,3S)-2-methyloxetan-3-yl]oxy-4-nitro-1-(trideuteriomethyl)pyrazole |
| SMILES | [2H]C([2H])([2H])n1cc([N+](=O)[O-])c(O[C@H]2CO[C@H]2C)n1 |
| InChI | InChI=1S/C8H11N3O4/c1-5-7(4-14-5)15-8-6(11(12)13)3-10(2)9-8/h3,5,7H,4H2,1-2H3/t5-,7-/m0/s1/i2D3 |
| InChIKey | BXGPJPQONDLGSR-NWURXPNHSA-N |
| XLogP | 0.49 |
| TPSA | 79.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.21 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|