C14H22N4O5 — CID 175819580
tert-butyl (3R)-2,2-dimethyl-3-(1-methyl-4-nitropyrazol-3-yl)oxyazetidine-1-carboxylate (PubChem CID 175819580) has the molecular formula C14H22N4O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is tert-butyl (3R)-2,2-dimethyl-3-(1-methyl-4-nitropyrazol-3-yl)oxyazetidine-1-carboxylate.
| Compound Name | tert-butyl (3R)-2,2-dimethyl-3-(1-methyl-4-nitropyrazol-3-yl)oxyazetidine-1-carboxylate |
|---|---|
| PubChem CID | 175819580 |
| Molecular Formula | C14H22N4O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | tert-butyl (3R)-2,2-dimethyl-3-(1-methyl-4-nitropyrazol-3-yl)oxyazetidine-1-carboxylate |
| SMILES | Cn1cc([N+](=O)[O-])c(O[C@@H]2CN(C(=O)OC(C)(C)C)C2(C)C)n1 |
| InChI | InChI=1S/C14H22N4O5/c1-13(2,3)23-12(19)17-8-10(14(17,4)5)22-11-9(18(20)21)7-16(6)15-11/h7,10H,8H2,1-6H3/t10-/m1/s1 |
| InChIKey | OTMRGAPQDYTKCM-SNVBAGLBSA-N |
| XLogP | 2.11 |
| TPSA | 99.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|