C10H13F2N3O3 — CID 175819576
N-[1-[(2R)-1,1-difluoropropan-2-yl]-3-(oxetan-3-yloxy)pyrazol-4-yl]formamide (PubChem CID 175819576) has the molecular formula C10H13F2N3O3 and a molecular weight of 261.23 g/mol. Its IUPAC name is N-[1-[(2R)-1,1-difluoropropan-2-yl]-3-(oxetan-3-yloxy)pyrazol-4-yl]formamide.
| Compound Name | N-[1-[(2R)-1,1-difluoropropan-2-yl]-3-(oxetan-3-yloxy)pyrazol-4-yl]formamide |
|---|---|
| PubChem CID | 175819576 |
| Molecular Formula | C10H13F2N3O3 |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | N-[1-[(2R)-1,1-difluoropropan-2-yl]-3-(oxetan-3-yloxy)pyrazol-4-yl]formamide |
| SMILES | C[C@H](C(F)F)n1cc(NC=O)c(OC2COC2)n1 |
| InChI | InChI=1S/C10H13F2N3O3/c1-6(9(11)12)15-2-8(13-5-16)10(14-15)18-7-3-17-4-7/h2,5-7,9H,3-4H2,1H3,(H,13,16)/t6-/m1/s1 |
| InChIKey | RSPBGCXTVLKSCK-ZCFIWIBFSA-N |
| XLogP | 1.06 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|