C25H34N2O — CID 175820841
2-methyl-5-[2-[(3R)-3-(oxolan-2-yl)-3-(2-phenylethyl)pyrrolidin-1-yl]propan-2-yl]pyridine (PubChem CID 175820841) has the molecular formula C25H34N2O and a molecular weight of 378.56 g/mol. Its IUPAC name is 2-methyl-5-[2-[(3R)-3-(oxolan-2-yl)-3-(2-phenylethyl)pyrrolidin-1-yl]propan-2-yl]pyridine.
| Compound Name | 2-methyl-5-[2-[(3R)-3-(oxolan-2-yl)-3-(2-phenylethyl)pyrrolidin-1-yl]propan-2-yl]pyridine |
|---|---|
| PubChem CID | 175820841 |
| Molecular Formula | C25H34N2O |
| Molecular Weight | 378.56 g/mol |
| Exact Mass | 378.27 |
| IUPAC Name | 2-methyl-5-[2-[(3R)-3-(oxolan-2-yl)-3-(2-phenylethyl)pyrrolidin-1-yl]propan-2-yl]pyridine |
| SMILES | Cc1ccc(C(C)(C)N2CC[C@@](CCc3ccccc3)(C3CCCO3)C2)cn1 |
| InChI | InChI=1S/C25H34N2O/c1-20-11-12-22(18-26-20)24(2,3)27-16-15-25(19-27,23-10-7-17-28-23)14-13-21-8-5-4-6-9-21/h4-6,8-9,11-12,18,23H,7,10,13-17,19H2,1-3H3/t23?,25-/m1/s1 |
| InChIKey | PIGPBBAOHCWQCU-XSWBTSGESA-N |
| XLogP | 5.13 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.56 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |