C23H33N3O — CID 162430455
1-methyl-5-[2-[3-(oxolan-2-yl)-3-(2-phenylethyl)pyrrolidin-1-yl]propan-2-yl]pyrazole (PubChem CID 162430455) has the molecular formula C23H33N3O and a molecular weight of 367.54 g/mol. Its IUPAC name is 1-methyl-5-[2-[3-(oxolan-2-yl)-3-(2-phenylethyl)pyrrolidin-1-yl]propan-2-yl]pyrazole.
| Compound Name | 1-methyl-5-[2-[3-(oxolan-2-yl)-3-(2-phenylethyl)pyrrolidin-1-yl]propan-2-yl]pyrazole |
|---|---|
| PubChem CID | 162430455 |
| Molecular Formula | C23H33N3O |
| Molecular Weight | 367.54 g/mol |
| Exact Mass | 367.26 |
| IUPAC Name | 1-methyl-5-[2-[3-(oxolan-2-yl)-3-(2-phenylethyl)pyrrolidin-1-yl]propan-2-yl]pyrazole |
| SMILES | Cn1nccc1C(C)(C)N1CCC(CCc2ccccc2)(C2CCCO2)C1 |
| InChI | InChI=1S/C23H33N3O/c1-22(2,20-12-15-24-25(20)3)26-16-14-23(18-26,21-10-7-17-27-21)13-11-19-8-5-4-6-9-19/h4-6,8-9,12,15,21H,7,10-11,13-14,16-18H2,1-3H3 |
| InChIKey | PHGVTAYICAASBB-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 30.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.54 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |