C25H19F3N4O — CID 175824528
3-cyano-N-[3-[2-ethyl-1-methyl-6-(trifluoromethyl)benzimidazol-5-yl]phenyl]benzamide (PubChem CID 175824528) has the molecular formula C25H19F3N4O and a molecular weight of 448.45 g/mol. Its IUPAC name is 3-cyano-N-[3-[2-ethyl-1-methyl-6-(trifluoromethyl)benzimidazol-5-yl]phenyl]benzamide.
| Compound Name | 3-cyano-N-[3-[2-ethyl-1-methyl-6-(trifluoromethyl)benzimidazol-5-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 175824528 |
| Molecular Formula | C25H19F3N4O |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | 3-cyano-N-[3-[2-ethyl-1-methyl-6-(trifluoromethyl)benzimidazol-5-yl]phenyl]benzamide |
| SMILES | CCc1nc2cc(-c3cccc(NC(=O)c4cccc(C#N)c4)c3)c(C(F)(F)F)cc2n1C |
| InChI | InChI=1S/C25H19F3N4O/c1-3-23-31-21-12-19(20(25(26,27)28)13-22(21)32(23)2)16-7-5-9-18(11-16)30-24(33)17-8-4-6-15(10-17)14-29/h4-13H,3H2,1-2H3,(H,30,33) |
| InChIKey | ADWZJEWRBYLUQF-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 70.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |